About magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide
magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide (PubChem CID 71389677) has the molecular formula C14H18Br2MgO3
and a molecular weight of 418.41 g/mol. Its IUPAC name is magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide.
Molecular Properties
| Compound Name | magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide |
| PubChem CID | 71389677 |
| Molecular Formula | C14H18Br2MgO3 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 415.95 |
| IUPAC Name | magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide |
| SMILES | CCCOC(=O)[C-](OCCC)c1ccc(Br)cc1.[Br-].[Mg+2] |
| InChI | InChI=1S/C14H18BrO3.BrH.Mg/c1-3-9-17-13(14(16)18-10-4-2)11-5-7-12(15)8-6-11;;/h5-8H,3-4,9-10H2,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | PIHDGSDYQGTQGC-UHFFFAOYSA-M |
| XLogP | 0.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide?
The IUPAC name of magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide (CID 71389677) is magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide.
What is the SMILES notation for magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide?
The canonical SMILES for magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide is CCCOC(=O)[C-](OCCC)c1ccc(Br)cc1.[Br-].[Mg+2].
What is the InChIKey of magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide?
The InChIKey is PIHDGSDYQGTQGC-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H18BrO3.BrH.Mg/c1-3-9-17-13(14(16)18-10-4-2)11-5-7-12(15)8-6-11;;/h5-8H,3-4,9-10H2,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide?
magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide has a molecular weight of 418.41 g/mol, XLogP of 0.33, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;propyl 2-(4-bromophenyl)-2-propoxyacetate;bromide is sourced from PubChem (CID 71389677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).