C5H9N5 — CID 71389708
1-prop-2-enyl-1,2,4-triazole-3,5-diamine (PubChem CID 71389708) has the molecular formula C5H9N5 and a molecular weight of 139.16 g/mol. Its IUPAC name is 1-prop-2-enyl-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-prop-2-enyl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 71389708 |
| Molecular Formula | C5H9N5 |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | 1-prop-2-enyl-1,2,4-triazole-3,5-diamine |
| SMILES | C=CCn1nc(N)nc1N |
| InChI | InChI=1S/C5H9N5/c1-2-3-10-5(7)8-4(6)9-10/h2H,1,3H2,(H4,6,7,8,9) |
| InChIKey | NMLHTWKFGWVBBK-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|