About 1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one
1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one (PubChem CID 71389709) has the molecular formula C5H3N5O5
and a molecular weight of 213.11 g/mol. Its IUPAC name is 1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one.
Molecular Properties
| Compound Name | 1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one |
| PubChem CID | 71389709 |
| Molecular Formula | C5H3N5O5 |
| Molecular Weight | 213.11 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)n1nc([N+](=O)[O-])nc1[N+](=O)[O-] |
| InChI | InChI=1S/C5H3N5O5/c1-2-3(11)8-5(10(14)15)6-4(7-8)9(12)13/h2H,1H2 |
| InChIKey | SAIZXYZFLXHNFP-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 134.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.11 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one?
The IUPAC name of 1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one (CID 71389709) is 1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one.
What is the SMILES notation for 1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one?
The canonical SMILES for 1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one is C=CC(=O)n1nc([N+](=O)[O-])nc1[N+](=O)[O-].
What is the InChIKey of 1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one?
The InChIKey is SAIZXYZFLXHNFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N5O5/c1-2-3(11)8-5(10(14)15)6-4(7-8)9(12)13/h2H,1H2.
What are the key properties of 1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one?
1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one has a molecular weight of 213.11 g/mol, XLogP of -0.08, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dinitro-1,2,4-triazol-1-yl)prop-2-en-1-one is sourced from PubChem (CID 71389709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).