2-(3,4-dimethoxyphenyl)acetic acid

C10H12O4 — CID 7139

IUPAC2-(3,4-dimethoxyphenyl)acetic acid
SMILESCOc1ccc(CC(=O)O)cc1OC
InChIInChI=1S/C10H12O4/c1-13-8-4-3-7(6-10(11)12)5-9(8)14-2/h3-5H,6H2,1-2H3,(H,11,12)
InChIKeyWUAXWQRULBZETB-UHFFFAOYSA-N
MW196.20 g/mol
LogP1.33
Rot. Bonds4

About 2-(3,4-dimethoxyphenyl)acetic acid

2-(3,4-dimethoxyphenyl)acetic acid (PubChem CID 7139) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)acetic acid.

Molecular Properties

Compound Name2-(3,4-dimethoxyphenyl)acetic acid
PubChem CID7139
Molecular FormulaC10H12O4
Molecular Weight196.20 g/mol
Exact Mass196.07
IUPAC Name2-(3,4-dimethoxyphenyl)acetic acid
SMILESCOc1ccc(CC(=O)O)cc1OC
InChIInChI=1S/C10H12O4/c1-13-8-4-3-7(6-10(11)12)5-9(8)14-2/h3-5H,6H2,1-2H3,(H,11,12)
InChIKeyWUAXWQRULBZETB-UHFFFAOYSA-N
XLogP1.33
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.20
LogP ≤ 51.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3,4-dimethoxyphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dimethoxyphenyl)acetic acid?
The IUPAC name of 2-(3,4-dimethoxyphenyl)acetic acid (CID 7139) is 2-(3,4-dimethoxyphenyl)acetic acid.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)acetic acid?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)acetic acid is COc1ccc(CC(=O)O)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)acetic acid?
The InChIKey is WUAXWQRULBZETB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-13-8-4-3-7(6-10(11)12)5-9(8)14-2/h3-5H,6H2,1-2H3,(H,11,12).
What are the key properties of 2-(3,4-dimethoxyphenyl)acetic acid?
2-(3,4-dimethoxyphenyl)acetic acid has a molecular weight of 196.20 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)acetic acid is sourced from PubChem (CID 7139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).