C17H22O5S2 — CID 71390019
4-[2-(3,4,5-trimethoxyphenyl)-1,3-dithian-2-yl]oxolan-2-one (PubChem CID 71390019) has the molecular formula C17H22O5S2 and a molecular weight of 370.49 g/mol. Its IUPAC name is 4-[2-(3,4,5-trimethoxyphenyl)-1,3-dithian-2-yl]oxolan-2-one.
| Compound Name | 4-[2-(3,4,5-trimethoxyphenyl)-1,3-dithian-2-yl]oxolan-2-one |
|---|---|
| PubChem CID | 71390019 |
| Molecular Formula | C17H22O5S2 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 4-[2-(3,4,5-trimethoxyphenyl)-1,3-dithian-2-yl]oxolan-2-one |
| SMILES | COc1cc(C2(C3COC(=O)C3)SCCCS2)cc(OC)c1OC |
| InChI | InChI=1S/C17H22O5S2/c1-19-13-7-11(8-14(20-2)16(13)21-3)17(23-5-4-6-24-17)12-9-15(18)22-10-12/h7-8,12H,4-6,9-10H2,1-3H3 |
| InChIKey | IHPNFXLKBTUTQZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |