About 5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one
5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one (PubChem CID 71390039) has the molecular formula C23H15NO3
and a molecular weight of 353.38 g/mol. Its IUPAC name is 5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one.
Molecular Properties
| Compound Name | 5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one |
| PubChem CID | 71390039 |
| Molecular Formula | C23H15NO3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one |
| SMILES | O=C(c1ccccc1)c1c(-c2ccccc2)nc(-c2ccccc2)oc1=O |
| InChI | InChI=1S/C23H15NO3/c25-21(17-12-6-2-7-13-17)19-20(16-10-4-1-5-11-16)24-22(27-23(19)26)18-14-8-3-9-15-18/h1-15H |
| InChIKey | RQUURNRPFQKXFA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one?
The IUPAC name of 5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one (CID 71390039) is 5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one.
What is the SMILES notation for 5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one?
The canonical SMILES for 5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one is O=C(c1ccccc1)c1c(-c2ccccc2)nc(-c2ccccc2)oc1=O.
What is the InChIKey of 5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one?
The InChIKey is RQUURNRPFQKXFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15NO3/c25-21(17-12-6-2-7-13-17)19-20(16-10-4-1-5-11-16)24-22(27-23(19)26)18-14-8-3-9-15-18/h1-15H.
What are the key properties of 5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one?
5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one has a molecular weight of 353.38 g/mol, XLogP of 4.60, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzoyl-2,4-diphenyl-1,3-oxazin-6-one is sourced from PubChem (CID 71390039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).