About 1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene
1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene (PubChem CID 71390342) has the molecular formula C8H15Cl2OP
and a molecular weight of 229.09 g/mol. Its IUPAC name is 1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene.
Molecular Properties
| Compound Name | 1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene |
| PubChem CID | 71390342 |
| Molecular Formula | C8H15Cl2OP |
| Molecular Weight | 229.09 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene |
| SMILES | CC(=CP(=O)(Cl)Cl)CC(C)(C)C |
| InChI | InChI=1S/C8H15Cl2OP/c1-7(5-8(2,3)4)6-12(9,10)11/h6H,5H2,1-4H3 |
| InChIKey | PSXFQRTXDJIMOK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.09 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene?
The IUPAC name of 1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene (CID 71390342) is 1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene.
What is the SMILES notation for 1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene?
The canonical SMILES for 1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene is CC(=CP(=O)(Cl)Cl)CC(C)(C)C.
What is the InChIKey of 1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene?
The InChIKey is PSXFQRTXDJIMOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15Cl2OP/c1-7(5-8(2,3)4)6-12(9,10)11/h6H,5H2,1-4H3.
What are the key properties of 1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene?
1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene has a molecular weight of 229.09 g/mol, XLogP of 5.00, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dichlorophosphoryl-2,4,4-trimethylpent-1-ene is sourced from PubChem (CID 71390342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).