About 2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde
2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde (PubChem CID 71390522) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde |
| PubChem CID | 71390522 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde |
| SMILES | CC(=O)CCC1(CC=O)OCCO1 |
| InChI | InChI=1S/C9H14O4/c1-8(11)2-3-9(4-5-10)12-6-7-13-9/h5H,2-4,6-7H2,1H3 |
| InChIKey | HNGMEKAPAMEJNP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde?
The IUPAC name of 2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde (CID 71390522) is 2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde.
What is the SMILES notation for 2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde?
The canonical SMILES for 2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde is CC(=O)CCC1(CC=O)OCCO1.
What is the InChIKey of 2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde?
The InChIKey is HNGMEKAPAMEJNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-8(11)2-3-9(4-5-10)12-6-7-13-9/h5H,2-4,6-7H2,1H3.
What are the key properties of 2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde?
2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde has a molecular weight of 186.21 g/mol, XLogP of 0.69, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-oxobutyl)-1,3-dioxolan-2-yl]acetaldehyde is sourced from PubChem (CID 71390522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).