C12H15NO2 — CID 71390796
N-(2,6,8-trimethyl-2,3-dihydrochromen-4-ylidene)hydroxylamine (PubChem CID 71390796) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is N-(2,6,8-trimethyl-2,3-dihydrochromen-4-ylidene)hydroxylamine.
| Compound Name | N-(2,6,8-trimethyl-2,3-dihydrochromen-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 71390796 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-(2,6,8-trimethyl-2,3-dihydrochromen-4-ylidene)hydroxylamine |
| SMILES | Cc1cc(C)c2c(c1)C(=NO)CC(C)O2 |
| InChI | InChI=1S/C12H15NO2/c1-7-4-8(2)12-10(5-7)11(13-14)6-9(3)15-12/h4-5,9,14H,6H2,1-3H3 |
| InChIKey | CHMBHOQLMFQOJH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|