About 3-amino-6-bromo-2,3-dihydrochromen-4-one
3-amino-6-bromo-2,3-dihydrochromen-4-one (PubChem CID 71390958) has the molecular formula C9H8BrNO2
and a molecular weight of 242.07 g/mol. Its IUPAC name is 3-amino-6-bromo-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 3-amino-6-bromo-2,3-dihydrochromen-4-one |
| PubChem CID | 71390958 |
| Molecular Formula | C9H8BrNO2 |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | 3-amino-6-bromo-2,3-dihydrochromen-4-one |
| SMILES | NC1COc2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C9H8BrNO2/c10-5-1-2-8-6(3-5)9(12)7(11)4-13-8/h1-3,7H,4,11H2 |
| InChIKey | QASJDHIXOGFJAM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-6-bromo-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-bromo-2,3-dihydrochromen-4-one?
The IUPAC name of 3-amino-6-bromo-2,3-dihydrochromen-4-one (CID 71390958) is 3-amino-6-bromo-2,3-dihydrochromen-4-one.
What is the SMILES notation for 3-amino-6-bromo-2,3-dihydrochromen-4-one?
The canonical SMILES for 3-amino-6-bromo-2,3-dihydrochromen-4-one is NC1COc2ccc(Br)cc2C1=O.
What is the InChIKey of 3-amino-6-bromo-2,3-dihydrochromen-4-one?
The InChIKey is QASJDHIXOGFJAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO2/c10-5-1-2-8-6(3-5)9(12)7(11)4-13-8/h1-3,7H,4,11H2.
What are the key properties of 3-amino-6-bromo-2,3-dihydrochromen-4-one?
3-amino-6-bromo-2,3-dihydrochromen-4-one has a molecular weight of 242.07 g/mol, XLogP of 1.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-bromo-2,3-dihydrochromen-4-one is sourced from PubChem (CID 71390958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).