C17H28N2 — CID 71391106
N,N,N',N'-tetraethyl-3-phenylprop-1-ene-1,3-diamine (PubChem CID 71391106) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is N,N,N',N'-tetraethyl-3-phenylprop-1-ene-1,3-diamine.
| Compound Name | N,N,N',N'-tetraethyl-3-phenylprop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 71391106 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N,N,N',N'-tetraethyl-3-phenylprop-1-ene-1,3-diamine |
| SMILES | CCN(C=CC(c1ccccc1)N(CC)CC)CC |
| InChI | InChI=1S/C17H28N2/c1-5-18(6-2)15-14-17(19(7-3)8-4)16-12-10-9-11-13-16/h9-15,17H,5-8H2,1-4H3 |
| InChIKey | PXTYVGZCRYHQRL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |