C12H8F6N4S — CID 71391291
4-(3,4-diamino-2,5,6-trifluorophenyl)sulfanyl-3,5,6-trifluorobenzene-1,2-diamine (PubChem CID 71391291) has the molecular formula C12H8F6N4S and a molecular weight of 354.28 g/mol. Its IUPAC name is 4-(3,4-diamino-2,5,6-trifluorophenyl)sulfanyl-3,5,6-trifluorobenzene-1,2-diamine.
| Compound Name | 4-(3,4-diamino-2,5,6-trifluorophenyl)sulfanyl-3,5,6-trifluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 71391291 |
| Molecular Formula | C12H8F6N4S |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 4-(3,4-diamino-2,5,6-trifluorophenyl)sulfanyl-3,5,6-trifluorobenzene-1,2-diamine |
| SMILES | Nc1c(N)c(F)c(Sc2c(F)c(N)c(N)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C12H8F6N4S/c13-1-3(15)11(5(17)9(21)7(1)19)23-12-4(16)2(14)8(20)10(22)6(12)18/h19-22H2 |
| InChIKey | GFYHQVWRPDYNNV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|