C22H30O2 — CID 71391497
6-ethenyl-8-[1-(3-ethenylocta-2,5,7-trienoxy)ethoxy]octa-1,3,6-triene (PubChem CID 71391497) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is 6-ethenyl-8-[1-(3-ethenylocta-2,5,7-trienoxy)ethoxy]octa-1,3,6-triene.
| Compound Name | 6-ethenyl-8-[1-(3-ethenylocta-2,5,7-trienoxy)ethoxy]octa-1,3,6-triene |
|---|---|
| PubChem CID | 71391497 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 6-ethenyl-8-[1-(3-ethenylocta-2,5,7-trienoxy)ethoxy]octa-1,3,6-triene |
| SMILES | C=CC=CCC(C=C)=CCOC(C)OCC=C(C=C)CC=CC=C |
| InChI | InChI=1S/C22H30O2/c1-6-10-12-14-21(8-3)16-18-23-20(5)24-19-17-22(9-4)15-13-11-7-2/h6-13,16-17,20H,1-4,14-15,18-19H2,5H3 |
| InChIKey | RFWRGXDISGPUTE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|