About 5-benzyl-2-phenyl-1,2,4,3-triazaphosphole
5-benzyl-2-phenyl-1,2,4,3-triazaphosphole (PubChem CID 71391893) has the molecular formula C14H12N3P
and a molecular weight of 253.25 g/mol. Its IUPAC name is 5-benzyl-2-phenyl-1,2,4,3-triazaphosphole.
Molecular Properties
| Compound Name | 5-benzyl-2-phenyl-1,2,4,3-triazaphosphole |
| PubChem CID | 71391893 |
| Molecular Formula | C14H12N3P |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 5-benzyl-2-phenyl-1,2,4,3-triazaphosphole |
| SMILES | c1ccc(Cc2npn(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C14H12N3P/c1-3-7-12(8-4-1)11-14-15-17(18-16-14)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | SZEUYSZOVZSHTC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzyl-2-phenyl-1,2,4,3-triazaphosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-2-phenyl-1,2,4,3-triazaphosphole?
The IUPAC name of 5-benzyl-2-phenyl-1,2,4,3-triazaphosphole (CID 71391893) is 5-benzyl-2-phenyl-1,2,4,3-triazaphosphole.
What is the SMILES notation for 5-benzyl-2-phenyl-1,2,4,3-triazaphosphole?
The canonical SMILES for 5-benzyl-2-phenyl-1,2,4,3-triazaphosphole is c1ccc(Cc2npn(-c3ccccc3)n2)cc1.
What is the InChIKey of 5-benzyl-2-phenyl-1,2,4,3-triazaphosphole?
The InChIKey is SZEUYSZOVZSHTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N3P/c1-3-7-12(8-4-1)11-14-15-17(18-16-14)13-9-5-2-6-10-13/h1-10H,11H2.
What are the key properties of 5-benzyl-2-phenyl-1,2,4,3-triazaphosphole?
5-benzyl-2-phenyl-1,2,4,3-triazaphosphole has a molecular weight of 253.25 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-2-phenyl-1,2,4,3-triazaphosphole is sourced from PubChem (CID 71391893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).