About 1,1,2-trichloro-3,4-dimethoxybut-1-ene
1,1,2-trichloro-3,4-dimethoxybut-1-ene (PubChem CID 71391951) has the molecular formula C6H9Cl3O2
and a molecular weight of 219.49 g/mol. Its IUPAC name is 1,1,2-trichloro-3,4-dimethoxybut-1-ene.
Molecular Properties
| Compound Name | 1,1,2-trichloro-3,4-dimethoxybut-1-ene |
| PubChem CID | 71391951 |
| Molecular Formula | C6H9Cl3O2 |
| Molecular Weight | 219.49 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | 1,1,2-trichloro-3,4-dimethoxybut-1-ene |
| SMILES | COCC(OC)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C6H9Cl3O2/c1-10-3-4(11-2)5(7)6(8)9/h4H,3H2,1-2H3 |
| InChIKey | ONHZSLBQJQWTTJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1,2-trichloro-3,4-dimethoxybut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-trichloro-3,4-dimethoxybut-1-ene?
The IUPAC name of 1,1,2-trichloro-3,4-dimethoxybut-1-ene (CID 71391951) is 1,1,2-trichloro-3,4-dimethoxybut-1-ene.
What is the SMILES notation for 1,1,2-trichloro-3,4-dimethoxybut-1-ene?
The canonical SMILES for 1,1,2-trichloro-3,4-dimethoxybut-1-ene is COCC(OC)C(Cl)=C(Cl)Cl.
What is the InChIKey of 1,1,2-trichloro-3,4-dimethoxybut-1-ene?
The InChIKey is ONHZSLBQJQWTTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9Cl3O2/c1-10-3-4(11-2)5(7)6(8)9/h4H,3H2,1-2H3.
What are the key properties of 1,1,2-trichloro-3,4-dimethoxybut-1-ene?
1,1,2-trichloro-3,4-dimethoxybut-1-ene has a molecular weight of 219.49 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-trichloro-3,4-dimethoxybut-1-ene is sourced from PubChem (CID 71391951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).