C5H8N4O3 — CID 71392003
6-(2-hydroxyethylamino)-1H-1,3,5-triazine-2,4-dione (PubChem CID 71392003) has the molecular formula C5H8N4O3 and a molecular weight of 172.14 g/mol. Its IUPAC name is 6-(2-hydroxyethylamino)-1H-1,3,5-triazine-2,4-dione.
| Compound Name | 6-(2-hydroxyethylamino)-1H-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 71392003 |
| Molecular Formula | C5H8N4O3 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 6-(2-hydroxyethylamino)-1H-1,3,5-triazine-2,4-dione |
| SMILES | O=c1nc(NCCO)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H8N4O3/c10-2-1-6-3-7-4(11)9-5(12)8-3/h10H,1-2H2,(H3,6,7,8,9,11,12) |
| InChIKey | IGWPESAZNAWAFW-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 110.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |