C12H16N4O — CID 7139234
5-[(2,3,6-trimethylphenoxy)methyl]-1H-1,2,4-triazol-3-amine (PubChem CID 7139234) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 5-[(2,3,6-trimethylphenoxy)methyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[(2,3,6-trimethylphenoxy)methyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 7139234 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 5-[(2,3,6-trimethylphenoxy)methyl]-1H-1,2,4-triazol-3-amine |
| SMILES | Cc1ccc(C)c(OCc2nc(N)n[nH]2)c1C |
| InChI | InChI=1S/C12H16N4O/c1-7-4-5-8(2)11(9(7)3)17-6-10-14-12(13)16-15-10/h4-5H,6H2,1-3H3,(H3,13,14,15,16) |
| InChIKey | IUJRKECKKXSBLD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |