About tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane
tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane (PubChem CID 71392869) has the molecular formula C32H41N3Sn
and a molecular weight of 586.41 g/mol. Its IUPAC name is tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane.
Molecular Properties
| Compound Name | tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane |
| PubChem CID | 71392869 |
| Molecular Formula | C32H41N3Sn |
| Molecular Weight | 586.41 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane |
| SMILES | CC(C)(C[Sn](CC(C)(C)c1ccccc1)(CC(C)(C)c1ccccc1)n1cncn1)c1ccccc1 |
| InChI | InChI=1S/3C10H13.C2H2N3.Sn/c3*1-10(2,3)9-7-5-4-6-8-9;1-3-2-5-4-1;/h3*4-8H,1H2,2-3H3;1-2H;/q;;;-1;+1 |
| InChIKey | HVOJUXALJUHBFV-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.41 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane?
The IUPAC name of tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane (CID 71392869) is tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane.
What is the SMILES notation for tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane?
The canonical SMILES for tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane is CC(C)(C[Sn](CC(C)(C)c1ccccc1)(CC(C)(C)c1ccccc1)n1cncn1)c1ccccc1.
What is the InChIKey of tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane?
The InChIKey is HVOJUXALJUHBFV-UHFFFAOYSA-N. The full InChI is InChI=1S/3C10H13.C2H2N3.Sn/c3*1-10(2,3)9-7-5-4-6-8-9;1-3-2-5-4-1;/h3*4-8H,1H2,2-3H3;1-2H;/q;;;-1;+1.
What are the key properties of tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane?
tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane has a molecular weight of 586.41 g/mol, XLogP of 8.01, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-methyl-2-phenylpropyl)-(1,2,4-triazol-1-yl)stannane is sourced from PubChem (CID 71392869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).