About 4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene
4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene (PubChem CID 71392970) has the molecular formula C9H18ClO3P
and a molecular weight of 240.67 g/mol. Its IUPAC name is 4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene.
Molecular Properties
| Compound Name | 4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene |
| PubChem CID | 71392970 |
| Molecular Formula | C9H18ClO3P |
| Molecular Weight | 240.67 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene |
| SMILES | COP(=O)(CC(C)(Cl)C=C(C)C)OC |
| InChI | InChI=1S/C9H18ClO3P/c1-8(2)6-9(3,10)7-14(11,12-4)13-5/h6H,7H2,1-5H3 |
| InChIKey | FQBZCSNYXVFAPG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.67 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene?
The IUPAC name of 4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene (CID 71392970) is 4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene.
What is the SMILES notation for 4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene?
The canonical SMILES for 4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene is COP(=O)(CC(C)(Cl)C=C(C)C)OC.
What is the InChIKey of 4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene?
The InChIKey is FQBZCSNYXVFAPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18ClO3P/c1-8(2)6-9(3,10)7-14(11,12-4)13-5/h6H,7H2,1-5H3.
What are the key properties of 4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene?
4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene has a molecular weight of 240.67 g/mol, XLogP of 3.44, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-dimethoxyphosphoryl-2,4-dimethylpent-2-ene is sourced from PubChem (CID 71392970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).