About 1-butylsulfanyl-3,4,5-trichloropent-2-ene
1-butylsulfanyl-3,4,5-trichloropent-2-ene (PubChem CID 71393206) has the molecular formula C9H15Cl3S
and a molecular weight of 261.64 g/mol. Its IUPAC name is 1-butylsulfanyl-3,4,5-trichloropent-2-ene.
Molecular Properties
| Compound Name | 1-butylsulfanyl-3,4,5-trichloropent-2-ene |
| PubChem CID | 71393206 |
| Molecular Formula | C9H15Cl3S |
| Molecular Weight | 261.64 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 1-butylsulfanyl-3,4,5-trichloropent-2-ene |
| SMILES | CCCCSCC=C(Cl)C(Cl)CCl |
| InChI | InChI=1S/C9H15Cl3S/c1-2-3-5-13-6-4-8(11)9(12)7-10/h4,9H,2-3,5-7H2,1H3 |
| InChIKey | SKUDBOCEAMGKPU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-butylsulfanyl-3,4,5-trichloropent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylsulfanyl-3,4,5-trichloropent-2-ene?
The IUPAC name of 1-butylsulfanyl-3,4,5-trichloropent-2-ene (CID 71393206) is 1-butylsulfanyl-3,4,5-trichloropent-2-ene.
What is the SMILES notation for 1-butylsulfanyl-3,4,5-trichloropent-2-ene?
The canonical SMILES for 1-butylsulfanyl-3,4,5-trichloropent-2-ene is CCCCSCC=C(Cl)C(Cl)CCl.
What is the InChIKey of 1-butylsulfanyl-3,4,5-trichloropent-2-ene?
The InChIKey is SKUDBOCEAMGKPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15Cl3S/c1-2-3-5-13-6-4-8(11)9(12)7-10/h4,9H,2-3,5-7H2,1H3.
What are the key properties of 1-butylsulfanyl-3,4,5-trichloropent-2-ene?
1-butylsulfanyl-3,4,5-trichloropent-2-ene has a molecular weight of 261.64 g/mol, XLogP of 4.49, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylsulfanyl-3,4,5-trichloropent-2-ene is sourced from PubChem (CID 71393206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).