About 2-(2,4,6-trichlorophenoxy)ethanamine
2-(2,4,6-trichlorophenoxy)ethanamine (PubChem CID 7139321) has the molecular formula C8H8Cl3NO
and a molecular weight of 240.52 g/mol. Its IUPAC name is 2-(2,4,6-trichlorophenoxy)ethanamine.
Molecular Properties
| Compound Name | 2-(2,4,6-trichlorophenoxy)ethanamine |
| PubChem CID | 7139321 |
| Molecular Formula | C8H8Cl3NO |
| Molecular Weight | 240.52 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | 2-(2,4,6-trichlorophenoxy)ethanamine |
| SMILES | NCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl3NO/c9-5-3-6(10)8(7(11)4-5)13-2-1-12/h3-4H,1-2,12H2 |
| InChIKey | SUSCJRQKCYABMX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,4,6-trichlorophenoxy)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4,6-trichlorophenoxy)ethanamine?
The IUPAC name of 2-(2,4,6-trichlorophenoxy)ethanamine (CID 7139321) is 2-(2,4,6-trichlorophenoxy)ethanamine.
What is the SMILES notation for 2-(2,4,6-trichlorophenoxy)ethanamine?
The canonical SMILES for 2-(2,4,6-trichlorophenoxy)ethanamine is NCCOc1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of 2-(2,4,6-trichlorophenoxy)ethanamine?
The InChIKey is SUSCJRQKCYABMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl3NO/c9-5-3-6(10)8(7(11)4-5)13-2-1-12/h3-4H,1-2,12H2.
What are the key properties of 2-(2,4,6-trichlorophenoxy)ethanamine?
2-(2,4,6-trichlorophenoxy)ethanamine has a molecular weight of 240.52 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,6-trichlorophenoxy)ethanamine is sourced from PubChem (CID 7139321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).