About 1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione
1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione (PubChem CID 71393325) has the molecular formula C16H22O3
and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione.
Molecular Properties
| Compound Name | 1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione |
| PubChem CID | 71393325 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione |
| SMILES | CC(C)COC1=CC(=O)C2(C=CC(=O)CC2)C(C)C1 |
| InChI | InChI=1S/C16H22O3/c1-11(2)10-19-14-8-12(3)16(15(18)9-14)6-4-13(17)5-7-16/h4,6,9,11-12H,5,7-8,10H2,1-3H3 |
| InChIKey | XQIGIWBYXIJREF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione?
The IUPAC name of 1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione (CID 71393325) is 1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione.
What is the SMILES notation for 1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione?
The canonical SMILES for 1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione is CC(C)COC1=CC(=O)C2(C=CC(=O)CC2)C(C)C1.
What is the InChIKey of 1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione?
The InChIKey is XQIGIWBYXIJREF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O3/c1-11(2)10-19-14-8-12(3)16(15(18)9-14)6-4-13(17)5-7-16/h4,6,9,11-12H,5,7-8,10H2,1-3H3.
What are the key properties of 1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione?
1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione has a molecular weight of 262.35 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(2-methylpropoxy)spiro[5.5]undeca-3,10-diene-5,9-dione is sourced from PubChem (CID 71393325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).