C12H14N2O — CID 71393609
(6aR,10aS)-6a,7,8,9,10,10a-hexahydro-5H-benzo[c][1,7]naphthyridin-6-one (PubChem CID 71393609) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is (6aR,10aS)-6a,7,8,9,10,10a-hexahydro-5H-benzo[c][1,7]naphthyridin-6-one.
| Compound Name | (6aR,10aS)-6a,7,8,9,10,10a-hexahydro-5H-benzo[c][1,7]naphthyridin-6-one |
|---|---|
| PubChem CID | 71393609 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (6aR,10aS)-6a,7,8,9,10,10a-hexahydro-5H-benzo[c][1,7]naphthyridin-6-one |
| SMILES | O=C1Nc2cnccc2[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C12H14N2O/c15-12-10-4-2-1-3-8(10)9-5-6-13-7-11(9)14-12/h5-8,10H,1-4H2,(H,14,15)/t8-,10-/m1/s1 |
| InChIKey | OZCVANJNLNNJAA-PSASIEDQSA-N |
| XLogP | 2.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |