C9H15NO — CID 71393782
1-ethyl-2,3,4,5-tetrahydroazocin-8-one (PubChem CID 71393782) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 1-ethyl-2,3,4,5-tetrahydroazocin-8-one.
| Compound Name | 1-ethyl-2,3,4,5-tetrahydroazocin-8-one |
|---|---|
| PubChem CID | 71393782 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1-ethyl-2,3,4,5-tetrahydroazocin-8-one |
| SMILES | CCN1CCCCC=CC1=O |
| InChI | InChI=1S/C9H15NO/c1-2-10-8-6-4-3-5-7-9(10)11/h5,7H,2-4,6,8H2,1H3 |
| InChIKey | CMNIWYOHSNKYQY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |