About (5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone
(5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone (PubChem CID 71393898) has the molecular formula C22H17N3O2
and a molecular weight of 355.40 g/mol. Its IUPAC name is (5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone |
| PubChem CID | 71393898 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1N=NN(c2ccccc2)C1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H17N3O2/c26-21(16-10-4-1-5-11-16)19-20(22(27)17-12-6-2-7-13-17)25(24-23-19)18-14-8-3-9-15-18/h1-15,19-20H |
| InChIKey | BXOQFUJGBGHVHK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone?
The IUPAC name of (5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone (CID 71393898) is (5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone.
What is the SMILES notation for (5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone?
The canonical SMILES for (5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone is O=C(c1ccccc1)C1N=NN(c2ccccc2)C1C(=O)c1ccccc1.
What is the InChIKey of (5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone?
The InChIKey is BXOQFUJGBGHVHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O2/c26-21(16-10-4-1-5-11-16)19-20(22(27)17-12-6-2-7-13-17)25(24-23-19)18-14-8-3-9-15-18/h1-15,19-20H.
What are the key properties of (5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone?
(5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone has a molecular weight of 355.40 g/mol, XLogP of 4.38, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-benzoyl-1-phenyl-4,5-dihydrotriazol-4-yl)-phenylmethanone is sourced from PubChem (CID 71393898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).