C11H13O4- — CID 7139419
2-(2-ethoxy-3-methoxyphenyl)acetate (PubChem CID 7139419) has the molecular formula C11H13O4- and a molecular weight of 209.22 g/mol. Its IUPAC name is 2-(2-ethoxy-3-methoxyphenyl)acetate.
| Compound Name | 2-(2-ethoxy-3-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 7139419 |
| Molecular Formula | C11H13O4- |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 2-(2-ethoxy-3-methoxyphenyl)acetate |
| SMILES | CCOc1c(CC(=O)[O-])cccc1OC |
| InChI | InChI=1S/C11H14O4/c1-3-15-11-8(7-10(12)13)5-4-6-9(11)14-2/h4-6H,3,7H2,1-2H3,(H,12,13)/p-1 |
| InChIKey | YTYPTSSUWVJINV-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |