About 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol
6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol (PubChem CID 71394256) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol.
Molecular Properties
| Compound Name | 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol |
| PubChem CID | 71394256 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol |
| SMILES | CC1(C)C2CC1C(O)C=C2O |
| InChI | InChI=1S/C9H14O2/c1-9(2)5-3-6(9)8(11)4-7(5)10/h4-7,10-11H,3H2,1-2H3 |
| InChIKey | BIJSJTUOWGRFOG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol?
The IUPAC name of 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol (CID 71394256) is 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol.
What is the SMILES notation for 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol?
The canonical SMILES for 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol is CC1(C)C2CC1C(O)C=C2O.
What is the InChIKey of 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol?
The InChIKey is BIJSJTUOWGRFOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-9(2)5-3-6(9)8(11)4-7(5)10/h4-7,10-11H,3H2,1-2H3.
What are the key properties of 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol?
6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol has a molecular weight of 154.21 g/mol, XLogP of 1.47, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2,4-diol is sourced from PubChem (CID 71394256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).