About (2S,4S)-2,4-dimethylthiane
(2S,4S)-2,4-dimethylthiane (PubChem CID 71394537) has the molecular formula C7H14S
and a molecular weight of 130.26 g/mol. Its IUPAC name is (2S,4S)-2,4-dimethylthiane.
Molecular Properties
| Compound Name | (2S,4S)-2,4-dimethylthiane |
| PubChem CID | 71394537 |
| Molecular Formula | C7H14S |
| Molecular Weight | 130.26 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | (2S,4S)-2,4-dimethylthiane |
| SMILES | C[C@H]1CCS[C@@H](C)C1 |
| InChI | InChI=1S/C7H14S/c1-6-3-4-8-7(2)5-6/h6-7H,3-5H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | ZUJJNQJNBRWNQH-BQBZGAKWSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,4S)-2,4-dimethylthiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-2,4-dimethylthiane?
The IUPAC name of (2S,4S)-2,4-dimethylthiane (CID 71394537) is (2S,4S)-2,4-dimethylthiane.
What is the SMILES notation for (2S,4S)-2,4-dimethylthiane?
The canonical SMILES for (2S,4S)-2,4-dimethylthiane is C[C@H]1CCS[C@@H](C)C1.
What is the InChIKey of (2S,4S)-2,4-dimethylthiane?
The InChIKey is ZUJJNQJNBRWNQH-BQBZGAKWSA-N. The full InChI is InChI=1S/C7H14S/c1-6-3-4-8-7(2)5-6/h6-7H,3-5H2,1-2H3/t6-,7-/m0/s1.
What are the key properties of (2S,4S)-2,4-dimethylthiane?
(2S,4S)-2,4-dimethylthiane has a molecular weight of 130.26 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-2,4-dimethylthiane is sourced from PubChem (CID 71394537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).