About 1-cyanobut-3-enyl N,N-dimethylcarbamodithioate
1-cyanobut-3-enyl N,N-dimethylcarbamodithioate (PubChem CID 71394823) has the molecular formula C8H12N2S2
and a molecular weight of 200.33 g/mol. Its IUPAC name is 1-cyanobut-3-enyl N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | 1-cyanobut-3-enyl N,N-dimethylcarbamodithioate |
| PubChem CID | 71394823 |
| Molecular Formula | C8H12N2S2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1-cyanobut-3-enyl N,N-dimethylcarbamodithioate |
| SMILES | C=CCC(C#N)SC(=S)N(C)C |
| InChI | InChI=1S/C8H12N2S2/c1-4-5-7(6-9)12-8(11)10(2)3/h4,7H,1,5H2,2-3H3 |
| InChIKey | UBQFTKCZUWNNKC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyanobut-3-enyl N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanobut-3-enyl N,N-dimethylcarbamodithioate?
The IUPAC name of 1-cyanobut-3-enyl N,N-dimethylcarbamodithioate (CID 71394823) is 1-cyanobut-3-enyl N,N-dimethylcarbamodithioate.
What is the SMILES notation for 1-cyanobut-3-enyl N,N-dimethylcarbamodithioate?
The canonical SMILES for 1-cyanobut-3-enyl N,N-dimethylcarbamodithioate is C=CCC(C#N)SC(=S)N(C)C.
What is the InChIKey of 1-cyanobut-3-enyl N,N-dimethylcarbamodithioate?
The InChIKey is UBQFTKCZUWNNKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S2/c1-4-5-7(6-9)12-8(11)10(2)3/h4,7H,1,5H2,2-3H3.
What are the key properties of 1-cyanobut-3-enyl N,N-dimethylcarbamodithioate?
1-cyanobut-3-enyl N,N-dimethylcarbamodithioate has a molecular weight of 200.33 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanobut-3-enyl N,N-dimethylcarbamodithioate is sourced from PubChem (CID 71394823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).