About S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate
S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate (PubChem CID 71395054) has the molecular formula C12H15NOS
and a molecular weight of 221.33 g/mol. Its IUPAC name is S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate.
Molecular Properties
| Compound Name | S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate |
| PubChem CID | 71395054 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate |
| SMILES | CC(C)SC(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H15NOS/c1-9(2)15-12(14)13-7-10-5-3-4-6-11(10)8-13/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | YGXPRVNRQASRPA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate?
The IUPAC name of S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate (CID 71395054) is S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate.
What is the SMILES notation for S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate?
The canonical SMILES for S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate is CC(C)SC(=O)N1Cc2ccccc2C1.
What is the InChIKey of S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate?
The InChIKey is YGXPRVNRQASRPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NOS/c1-9(2)15-12(14)13-7-10-5-3-4-6-11(10)8-13/h3-6,9H,7-8H2,1-2H3.
What are the key properties of S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate?
S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate has a molecular weight of 221.33 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-propan-2-yl 1,3-dihydroisoindole-2-carbothioate is sourced from PubChem (CID 71395054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).