C10H9N7 — CID 71395619
(4,6-diamino-5-phenyl-1,3,5-triazin-2-ylidene)cyanamide (PubChem CID 71395619) has the molecular formula C10H9N7 and a molecular weight of 227.23 g/mol. Its IUPAC name is (4,6-diamino-5-phenyl-1,3,5-triazin-2-ylidene)cyanamide.
| Compound Name | (4,6-diamino-5-phenyl-1,3,5-triazin-2-ylidene)cyanamide |
|---|---|
| PubChem CID | 71395619 |
| Molecular Formula | C10H9N7 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (4,6-diamino-5-phenyl-1,3,5-triazin-2-ylidene)cyanamide |
| SMILES | N#CN=c1nc(N)n(-c2ccccc2)c(N)n1 |
| InChI | InChI=1S/C10H9N7/c11-6-14-10-15-8(12)17(9(13)16-10)7-4-2-1-3-5-7/h1-5H,(H4,12,13,14,15,16) |
| InChIKey | PPZSLLWPZOODPQ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|