About 6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran
6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran (PubChem CID 71395626) has the molecular formula C15H18OS
and a molecular weight of 246.38 g/mol. Its IUPAC name is 6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran.
Molecular Properties
| Compound Name | 6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran |
| PubChem CID | 71395626 |
| Molecular Formula | C15H18OS |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran |
| SMILES | CC1(C)CC(C=CSc2ccccc2)=CCO1 |
| InChI | InChI=1S/C15H18OS/c1-15(2)12-13(8-10-16-15)9-11-17-14-6-4-3-5-7-14/h3-9,11H,10,12H2,1-2H3 |
| InChIKey | PPYDADFTAPOUKG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran?
The IUPAC name of 6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran (CID 71395626) is 6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran.
What is the SMILES notation for 6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran?
The canonical SMILES for 6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran is CC1(C)CC(C=CSc2ccccc2)=CCO1.
What is the InChIKey of 6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran?
The InChIKey is PPYDADFTAPOUKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18OS/c1-15(2)12-13(8-10-16-15)9-11-17-14-6-4-3-5-7-14/h3-9,11H,10,12H2,1-2H3.
What are the key properties of 6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran?
6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran has a molecular weight of 246.38 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-4-(2-phenylsulfanylethenyl)-2,5-dihydropyran is sourced from PubChem (CID 71395626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).