About benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite
benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite (PubChem CID 71395725) has the molecular formula C19H31NO5P-
and a molecular weight of 384.43 g/mol. Its IUPAC name is benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite.
Molecular Properties
| Compound Name | benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite |
| PubChem CID | 71395725 |
| Molecular Formula | C19H31NO5P- |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite |
| SMILES | CC(C)NC(CCOP([O-])OCc1ccccc1)CC1COC(C)(C)O1 |
| InChI | InChI=1S/C19H31NO5P/c1-15(2)20-17(12-18-14-22-19(3,4)25-18)10-11-23-26(21)24-13-16-8-6-5-7-9-16/h5-9,15,17-18,20H,10-14H2,1-4H3/q-1 |
| InChIKey | HWSKYWGTDDCVPH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite?
The IUPAC name of benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite (CID 71395725) is benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite.
What is the SMILES notation for benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite?
The canonical SMILES for benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite is CC(C)NC(CCOP([O-])OCc1ccccc1)CC1COC(C)(C)O1.
What is the InChIKey of benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite?
The InChIKey is HWSKYWGTDDCVPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31NO5P/c1-15(2)20-17(12-18-14-22-19(3,4)25-18)10-11-23-26(21)24-13-16-8-6-5-7-9-16/h5-9,15,17-18,20H,10-14H2,1-4H3/q-1.
What are the key properties of benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite?
benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite has a molecular weight of 384.43 g/mol, XLogP of 3.11, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl [4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-(propan-2-ylamino)butyl] phosphite is sourced from PubChem (CID 71395725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).