C9H6Cl2N4S — CID 71395734
2-amino-6-(2,5-dichlorophenyl)-1H-1,3,5-triazine-4-thione (PubChem CID 71395734) has the molecular formula C9H6Cl2N4S and a molecular weight of 273.15 g/mol. Its IUPAC name is 2-amino-6-(2,5-dichlorophenyl)-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-amino-6-(2,5-dichlorophenyl)-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 71395734 |
| Molecular Formula | C9H6Cl2N4S |
| Molecular Weight | 273.15 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 2-amino-6-(2,5-dichlorophenyl)-1H-1,3,5-triazine-4-thione |
| SMILES | Nc1nc(=S)nc(-c2cc(Cl)ccc2Cl)[nH]1 |
| InChI | InChI=1S/C9H6Cl2N4S/c10-4-1-2-6(11)5(3-4)7-13-8(12)15-9(16)14-7/h1-3H,(H3,12,13,14,15,16) |
| InChIKey | SCEMUDNFWGBJBM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.15 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|