About 1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene
1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene (PubChem CID 71395804) has the molecular formula C8H7Cl4N2O2P
and a molecular weight of 335.94 g/mol. Its IUPAC name is 1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene.
Molecular Properties
| Compound Name | 1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene |
| PubChem CID | 71395804 |
| Molecular Formula | C8H7Cl4N2O2P |
| Molecular Weight | 335.94 g/mol |
| Exact Mass | 333.90 |
| IUPAC Name | 1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene |
| SMILES | NP(N)(=O)OC(=C(Cl)Cl)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H7Cl4N2O2P/c9-5-3-1-2-4(6(5)10)7(8(11)12)16-17(13,14)15/h1-3H,(H4,13,14,15) |
| InChIKey | HMAUNNBUTIEZMC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.94 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene?
The IUPAC name of 1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene (CID 71395804) is 1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene.
What is the SMILES notation for 1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene?
The canonical SMILES for 1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene is NP(N)(=O)OC(=C(Cl)Cl)c1cccc(Cl)c1Cl.
What is the InChIKey of 1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene?
The InChIKey is HMAUNNBUTIEZMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl4N2O2P/c9-5-3-1-2-4(6(5)10)7(8(11)12)16-17(13,14)15/h1-3H,(H4,13,14,15).
What are the key properties of 1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene?
1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene has a molecular weight of 335.94 g/mol, XLogP of 4.14, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-3-(2,2-dichloro-1-diaminophosphoryloxyethenyl)benzene is sourced from PubChem (CID 71395804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).