About acetic acid;5,5,5-tribromo-2-methylpentan-2-ol
acetic acid;5,5,5-tribromo-2-methylpentan-2-ol (PubChem CID 71395814) has the molecular formula C8H15Br3O3
and a molecular weight of 398.92 g/mol. Its IUPAC name is acetic acid;5,5,5-tribromo-2-methylpentan-2-ol.
Molecular Properties
| Compound Name | acetic acid;5,5,5-tribromo-2-methylpentan-2-ol |
| PubChem CID | 71395814 |
| Molecular Formula | C8H15Br3O3 |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 395.86 |
| IUPAC Name | acetic acid;5,5,5-tribromo-2-methylpentan-2-ol |
| SMILES | CC(=O)O.CC(C)(O)CCC(Br)(Br)Br |
| InChI | InChI=1S/C6H11Br3O.C2H4O2/c1-5(2,10)3-4-6(7,8)9;1-2(3)4/h10H,3-4H2,1-2H3;1H3,(H,3,4) |
| InChIKey | ADIOEJMTTIRDSO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;5,5,5-tribromo-2-methylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;5,5,5-tribromo-2-methylpentan-2-ol?
The IUPAC name of acetic acid;5,5,5-tribromo-2-methylpentan-2-ol (CID 71395814) is acetic acid;5,5,5-tribromo-2-methylpentan-2-ol.
What is the SMILES notation for acetic acid;5,5,5-tribromo-2-methylpentan-2-ol?
The canonical SMILES for acetic acid;5,5,5-tribromo-2-methylpentan-2-ol is CC(=O)O.CC(C)(O)CCC(Br)(Br)Br.
What is the InChIKey of acetic acid;5,5,5-tribromo-2-methylpentan-2-ol?
The InChIKey is ADIOEJMTTIRDSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11Br3O.C2H4O2/c1-5(2,10)3-4-6(7,8)9;1-2(3)4/h10H,3-4H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;5,5,5-tribromo-2-methylpentan-2-ol?
acetic acid;5,5,5-tribromo-2-methylpentan-2-ol has a molecular weight of 398.92 g/mol, XLogP of 3.47, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;5,5,5-tribromo-2-methylpentan-2-ol is sourced from PubChem (CID 71395814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).