About (4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane
(4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane (PubChem CID 71396029) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is (4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane.
Molecular Properties
| Compound Name | (4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane |
| PubChem CID | 71396029 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane |
| SMILES | C#CC(C)(C1CC1)C(C)(C#C)C1CC1 |
| InChI | InChI=1S/C14H18/c1-5-13(3,11-7-8-11)14(4,6-2)12-9-10-12/h1-2,11-12H,7-10H2,3-4H3 |
| InChIKey | MBIWPWSQFIBBKB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane?
The IUPAC name of (4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane (CID 71396029) is (4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane.
What is the SMILES notation for (4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane?
The canonical SMILES for (4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane is C#CC(C)(C1CC1)C(C)(C#C)C1CC1.
What is the InChIKey of (4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane?
The InChIKey is MBIWPWSQFIBBKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18/c1-5-13(3,11-7-8-11)14(4,6-2)12-9-10-12/h1-2,11-12H,7-10H2,3-4H3.
What are the key properties of (4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane?
(4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane has a molecular weight of 186.30 g/mol, XLogP of 3.09, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclopropyl-3,4-dimethylhexa-1,5-diyn-3-yl)cyclopropane is sourced from PubChem (CID 71396029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).