About 1-iodo-3-methylocta-1,2,7-triene
1-iodo-3-methylocta-1,2,7-triene (PubChem CID 71396037) has the molecular formula C9H13I
and a molecular weight of 248.11 g/mol. Its IUPAC name is 1-iodo-3-methylocta-1,2,7-triene.
Molecular Properties
| Compound Name | 1-iodo-3-methylocta-1,2,7-triene |
| PubChem CID | 71396037 |
| Molecular Formula | C9H13I |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 1-iodo-3-methylocta-1,2,7-triene |
| SMILES | C=CCCCC(C)=C=CI |
| InChI | InChI=1S/C9H13I/c1-3-4-5-6-9(2)7-8-10/h3,8H,1,4-6H2,2H3 |
| InChIKey | SNCFSFYWLXAMOT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-3-methylocta-1,2,7-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-3-methylocta-1,2,7-triene?
The IUPAC name of 1-iodo-3-methylocta-1,2,7-triene (CID 71396037) is 1-iodo-3-methylocta-1,2,7-triene.
What is the SMILES notation for 1-iodo-3-methylocta-1,2,7-triene?
The canonical SMILES for 1-iodo-3-methylocta-1,2,7-triene is C=CCCCC(C)=C=CI.
What is the InChIKey of 1-iodo-3-methylocta-1,2,7-triene?
The InChIKey is SNCFSFYWLXAMOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13I/c1-3-4-5-6-9(2)7-8-10/h3,8H,1,4-6H2,2H3.
What are the key properties of 1-iodo-3-methylocta-1,2,7-triene?
1-iodo-3-methylocta-1,2,7-triene has a molecular weight of 248.11 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-3-methylocta-1,2,7-triene is sourced from PubChem (CID 71396037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).