About naphthalen-2-yl N-prop-2-enylcarbamate
naphthalen-2-yl N-prop-2-enylcarbamate (PubChem CID 71396312) has the molecular formula C14H13NO2
and a molecular weight of 227.26 g/mol. Its IUPAC name is naphthalen-2-yl N-prop-2-enylcarbamate.
Molecular Properties
| Compound Name | naphthalen-2-yl N-prop-2-enylcarbamate |
| PubChem CID | 71396312 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | naphthalen-2-yl N-prop-2-enylcarbamate |
| SMILES | C=CCNC(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H13NO2/c1-2-9-15-14(16)17-13-8-7-11-5-3-4-6-12(11)10-13/h2-8,10H,1,9H2,(H,15,16) |
| InChIKey | BODHFJPPDOEJHR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-yl N-prop-2-enylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-yl N-prop-2-enylcarbamate?
The IUPAC name of naphthalen-2-yl N-prop-2-enylcarbamate (CID 71396312) is naphthalen-2-yl N-prop-2-enylcarbamate.
What is the SMILES notation for naphthalen-2-yl N-prop-2-enylcarbamate?
The canonical SMILES for naphthalen-2-yl N-prop-2-enylcarbamate is C=CCNC(=O)Oc1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-yl N-prop-2-enylcarbamate?
The InChIKey is BODHFJPPDOEJHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2/c1-2-9-15-14(16)17-13-8-7-11-5-3-4-6-12(11)10-13/h2-8,10H,1,9H2,(H,15,16).
What are the key properties of naphthalen-2-yl N-prop-2-enylcarbamate?
naphthalen-2-yl N-prop-2-enylcarbamate has a molecular weight of 227.26 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-yl N-prop-2-enylcarbamate is sourced from PubChem (CID 71396312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).