About 3-chloropropyl(triphenyl)phosphanium;gold
3-chloropropyl(triphenyl)phosphanium;gold (PubChem CID 71396572) has the molecular formula C21H21AuClP+
and a molecular weight of 536.79 g/mol. Its IUPAC name is 3-chloropropyl(triphenyl)phosphanium;gold.
Molecular Properties
| Compound Name | 3-chloropropyl(triphenyl)phosphanium;gold |
| PubChem CID | 71396572 |
| Molecular Formula | C21H21AuClP+ |
| Molecular Weight | 536.79 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | 3-chloropropyl(triphenyl)phosphanium;gold |
| SMILES | ClCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Au] |
| InChI | InChI=1S/C21H21ClP.Au/c22-17-10-18-23(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;/h1-9,11-16H,10,17-18H2;/q+1; |
| InChIKey | JSUYNUAJRUICMZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 536.79 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropropyl(triphenyl)phosphanium;gold with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropropyl(triphenyl)phosphanium;gold?
The IUPAC name of 3-chloropropyl(triphenyl)phosphanium;gold (CID 71396572) is 3-chloropropyl(triphenyl)phosphanium;gold.
What is the SMILES notation for 3-chloropropyl(triphenyl)phosphanium;gold?
The canonical SMILES for 3-chloropropyl(triphenyl)phosphanium;gold is ClCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Au].
What is the InChIKey of 3-chloropropyl(triphenyl)phosphanium;gold?
The InChIKey is JSUYNUAJRUICMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClP.Au/c22-17-10-18-23(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;/h1-9,11-16H,10,17-18H2;/q+1;.
What are the key properties of 3-chloropropyl(triphenyl)phosphanium;gold?
3-chloropropyl(triphenyl)phosphanium;gold has a molecular weight of 536.79 g/mol, XLogP of 4.61, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropropyl(triphenyl)phosphanium;gold is sourced from PubChem (CID 71396572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).