C11H10Cl4 — CID 71396624
1-(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-yl)cyclohexene (PubChem CID 71396624) has the molecular formula C11H10Cl4 and a molecular weight of 284.01 g/mol. Its IUPAC name is 1-(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-yl)cyclohexene.
| Compound Name | 1-(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-yl)cyclohexene |
|---|---|
| PubChem CID | 71396624 |
| Molecular Formula | C11H10Cl4 |
| Molecular Weight | 284.01 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 1-(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-yl)cyclohexene |
| SMILES | ClC1=C(Cl)C(C2=CCCCC2)C(Cl)=C1Cl |
| InChI | InChI=1S/C11H10Cl4/c12-8-7(6-4-2-1-3-5-6)9(13)11(15)10(8)14/h4,7H,1-3,5H2 |
| InChIKey | MPXXEIMGYOGPPG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.01 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|