C28H25NO4 — CID 71396676
5-benzoyl-3-butyl-2,4-diphenyl-2H-1,3-oxazepine-6,7-dione (PubChem CID 71396676) has the molecular formula C28H25NO4 and a molecular weight of 439.51 g/mol. Its IUPAC name is 5-benzoyl-3-butyl-2,4-diphenyl-2H-1,3-oxazepine-6,7-dione.
| Compound Name | 5-benzoyl-3-butyl-2,4-diphenyl-2H-1,3-oxazepine-6,7-dione |
|---|---|
| PubChem CID | 71396676 |
| Molecular Formula | C28H25NO4 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 5-benzoyl-3-butyl-2,4-diphenyl-2H-1,3-oxazepine-6,7-dione |
| SMILES | CCCCN1C(c2ccccc2)=C(C(=O)c2ccccc2)C(=O)C(=O)OC1c1ccccc1 |
| InChI | InChI=1S/C28H25NO4/c1-2-3-19-29-24(20-13-7-4-8-14-20)23(25(30)21-15-9-5-10-16-21)26(31)28(32)33-27(29)22-17-11-6-12-18-22/h4-18,27H,2-3,19H2,1H3 |
| InChIKey | PAJYJENCDBBCCD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|