C11H16O2 — CID 71396870
(3aR,7aR)-3a,5,6-trimethyl-3,4,7,7a-tetrahydro-2-benzofuran-1-one (PubChem CID 71396870) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (3aR,7aR)-3a,5,6-trimethyl-3,4,7,7a-tetrahydro-2-benzofuran-1-one.
| Compound Name | (3aR,7aR)-3a,5,6-trimethyl-3,4,7,7a-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 71396870 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (3aR,7aR)-3a,5,6-trimethyl-3,4,7,7a-tetrahydro-2-benzofuran-1-one |
| SMILES | CC1=C(C)C[C@@]2(C)COC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C11H16O2/c1-7-4-9-10(12)13-6-11(9,3)5-8(7)2/h9H,4-6H2,1-3H3/t9-,11-/m0/s1 |
| InChIKey | NSKURVUHJQVTDL-ONGXEEELSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|