About (3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane
(3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 71396910) has the molecular formula C17H17N2PS
and a molecular weight of 312.38 g/mol. Its IUPAC name is (3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | (3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane |
| PubChem CID | 71396910 |
| Molecular Formula | C17H17N2PS |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | Cc1cc(C)n(P(=S)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C17H17N2PS/c1-14-13-15(2)19(18-14)20(21,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-13H,1-2H3 |
| InChIKey | SCVXJNZTNBUHOG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane?
The IUPAC name of (3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane (CID 71396910) is (3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane.
What is the SMILES notation for (3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane?
The canonical SMILES for (3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane is Cc1cc(C)n(P(=S)(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of (3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane?
The InChIKey is SCVXJNZTNBUHOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N2PS/c1-14-13-15(2)19(18-14)20(21,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-13H,1-2H3.
What are the key properties of (3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane?
(3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane has a molecular weight of 312.38 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethylpyrazol-1-yl)-diphenyl-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 71396910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).