About 3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole
3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole (PubChem CID 71396998) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole |
| PubChem CID | 71396998 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole |
| SMILES | Cc1ccnc(-c2onc(C)c2C)c1 |
| InChI | InChI=1S/C11H12N2O/c1-7-4-5-12-10(6-7)11-8(2)9(3)13-14-11/h4-6H,1-3H3 |
| InChIKey | CNYVKJFDWHUWEH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole?
The IUPAC name of 3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole (CID 71396998) is 3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole.
What is the SMILES notation for 3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole?
The canonical SMILES for 3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole is Cc1ccnc(-c2onc(C)c2C)c1.
What is the InChIKey of 3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole?
The InChIKey is CNYVKJFDWHUWEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-7-4-5-12-10(6-7)11-8(2)9(3)13-14-11/h4-6H,1-3H3.
What are the key properties of 3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole?
3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole has a molecular weight of 188.23 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-5-(4-methyl-2-pyridinyl)-1,2-oxazole is sourced from PubChem (CID 71396998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).