About 1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one
1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one (PubChem CID 71397212) has the molecular formula C20H21NO
and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one.
Molecular Properties
| Compound Name | 1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one |
| PubChem CID | 71397212 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one |
| SMILES | Cc1ccc(Cn2c(=O)c(C)c(C)c3ccccc32)cc1C |
| InChI | InChI=1S/C20H21NO/c1-13-9-10-17(11-14(13)2)12-21-19-8-6-5-7-18(19)15(3)16(4)20(21)22/h5-11H,12H2,1-4H3 |
| InChIKey | GPEYYIAATZFOTD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one?
The IUPAC name of 1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one (CID 71397212) is 1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one.
What is the SMILES notation for 1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one?
The canonical SMILES for 1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one is Cc1ccc(Cn2c(=O)c(C)c(C)c3ccccc32)cc1C.
What is the InChIKey of 1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one?
The InChIKey is GPEYYIAATZFOTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO/c1-13-9-10-17(11-14(13)2)12-21-19-8-6-5-7-18(19)15(3)16(4)20(21)22/h5-11H,12H2,1-4H3.
What are the key properties of 1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one?
1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one has a molecular weight of 291.39 g/mol, XLogP of 4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dimethylphenyl)methyl]-3,4-dimethylquinolin-2-one is sourced from PubChem (CID 71397212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).