About propyl 4-bromobenzenesulfonate
propyl 4-bromobenzenesulfonate (PubChem CID 71397621) has the molecular formula C9H11BrO3S
and a molecular weight of 279.15 g/mol. Its IUPAC name is propyl 4-bromobenzenesulfonate.
Molecular Properties
| Compound Name | propyl 4-bromobenzenesulfonate |
| PubChem CID | 71397621 |
| Molecular Formula | C9H11BrO3S |
| Molecular Weight | 279.15 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | propyl 4-bromobenzenesulfonate |
| SMILES | CCCOS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H11BrO3S/c1-2-7-13-14(11,12)9-5-3-8(10)4-6-9/h3-6H,2,7H2,1H3 |
| InChIKey | ABXDVLYISWZBOT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.15 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze propyl 4-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 4-bromobenzenesulfonate?
The IUPAC name of propyl 4-bromobenzenesulfonate (CID 71397621) is propyl 4-bromobenzenesulfonate.
What is the SMILES notation for propyl 4-bromobenzenesulfonate?
The canonical SMILES for propyl 4-bromobenzenesulfonate is CCCOS(=O)(=O)c1ccc(Br)cc1.
What is the InChIKey of propyl 4-bromobenzenesulfonate?
The InChIKey is ABXDVLYISWZBOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO3S/c1-2-7-13-14(11,12)9-5-3-8(10)4-6-9/h3-6H,2,7H2,1H3.
What are the key properties of propyl 4-bromobenzenesulfonate?
propyl 4-bromobenzenesulfonate has a molecular weight of 279.15 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 4-bromobenzenesulfonate is sourced from PubChem (CID 71397621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).