C16H28OS — CID 71397781
3,7,11-trimethyl-4-methylsulfanyldodeca-2,6,10-trien-1-ol (PubChem CID 71397781) has the molecular formula C16H28OS and a molecular weight of 268.47 g/mol. Its IUPAC name is 3,7,11-trimethyl-4-methylsulfanyldodeca-2,6,10-trien-1-ol.
| Compound Name | 3,7,11-trimethyl-4-methylsulfanyldodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 71397781 |
| Molecular Formula | C16H28OS |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 3,7,11-trimethyl-4-methylsulfanyldodeca-2,6,10-trien-1-ol |
| SMILES | CSC(CC=C(C)CCC=C(C)C)C(C)=CCO |
| InChI | InChI=1S/C16H28OS/c1-13(2)7-6-8-14(3)9-10-16(18-5)15(4)11-12-17/h7,9,11,16-17H,6,8,10,12H2,1-5H3 |
| InChIKey | PKHPYHKDLLPROT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|