About tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane
tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane (PubChem CID 71397950) has the molecular formula C17H36Si2
and a molecular weight of 296.65 g/mol. Its IUPAC name is tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane |
| PubChem CID | 71397950 |
| Molecular Formula | C17H36Si2 |
| Molecular Weight | 296.65 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane |
| SMILES | CC(C)=C=C([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36Si2/c1-14(2)13-15(18(9,10)16(3,4)5)19(11,12)17(6,7)8/h1-12H3 |
| InChIKey | LNYWXEAJLXQCPF-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane?
The IUPAC name of tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane (CID 71397950) is tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane.
What is the SMILES notation for tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane?
The canonical SMILES for tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane is CC(C)=C=C([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane?
The InChIKey is LNYWXEAJLXQCPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36Si2/c1-14(2)13-15(18(9,10)16(3,4)5)19(11,12)17(6,7)8/h1-12H3.
What are the key properties of tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane?
tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane has a molecular weight of 296.65 g/mol, XLogP of 6.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[1-[tert-butyl(dimethyl)silyl]-3-methylbuta-1,2-dienyl]-dimethylsilane is sourced from PubChem (CID 71397950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).