About 6-bromo-6-chloro-1,4-dioxepane-5,7-diol
6-bromo-6-chloro-1,4-dioxepane-5,7-diol (PubChem CID 71398250) has the molecular formula C5H8BrClO4
and a molecular weight of 247.47 g/mol. Its IUPAC name is 6-bromo-6-chloro-1,4-dioxepane-5,7-diol.
Molecular Properties
| Compound Name | 6-bromo-6-chloro-1,4-dioxepane-5,7-diol |
| PubChem CID | 71398250 |
| Molecular Formula | C5H8BrClO4 |
| Molecular Weight | 247.47 g/mol |
| Exact Mass | 245.93 |
| IUPAC Name | 6-bromo-6-chloro-1,4-dioxepane-5,7-diol |
| SMILES | OC1OCCOC(O)C1(Cl)Br |
| InChI | InChI=1S/C5H8BrClO4/c6-5(7)3(8)10-1-2-11-4(5)9/h3-4,8-9H,1-2H2 |
| InChIKey | ARNZFICZDYKJRN-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.47 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-6-chloro-1,4-dioxepane-5,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-6-chloro-1,4-dioxepane-5,7-diol?
The IUPAC name of 6-bromo-6-chloro-1,4-dioxepane-5,7-diol (CID 71398250) is 6-bromo-6-chloro-1,4-dioxepane-5,7-diol.
What is the SMILES notation for 6-bromo-6-chloro-1,4-dioxepane-5,7-diol?
The canonical SMILES for 6-bromo-6-chloro-1,4-dioxepane-5,7-diol is OC1OCCOC(O)C1(Cl)Br.
What is the InChIKey of 6-bromo-6-chloro-1,4-dioxepane-5,7-diol?
The InChIKey is ARNZFICZDYKJRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BrClO4/c6-5(7)3(8)10-1-2-11-4(5)9/h3-4,8-9H,1-2H2.
What are the key properties of 6-bromo-6-chloro-1,4-dioxepane-5,7-diol?
6-bromo-6-chloro-1,4-dioxepane-5,7-diol has a molecular weight of 247.47 g/mol, XLogP of 0.00, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-6-chloro-1,4-dioxepane-5,7-diol is sourced from PubChem (CID 71398250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).